C14H12F6O10S2 — CID 10918341
dimethyl (3aR,6aR)-2,5-bis(trifluoromethylsulfonyloxy)-1,4-dihydropentalene-3a,6a-dicarboxylate (PubChem CID 10918341) has the molecular formula C14H12F6O10S2 and a molecular weight of 518.36 g/mol. Its IUPAC name is dimethyl (3aR,6aR)-2,5-bis(trifluoromethylsulfonyloxy)-1,4-dihydropentalene-3a,6a-dicarboxylate.
| Compound Name | dimethyl (3aR,6aR)-2,5-bis(trifluoromethylsulfonyloxy)-1,4-dihydropentalene-3a,6a-dicarboxylate |
|---|---|
| PubChem CID | 10918341 |
| Molecular Formula | C14H12F6O10S2 |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 517.98 |
| IUPAC Name | dimethyl (3aR,6aR)-2,5-bis(trifluoromethylsulfonyloxy)-1,4-dihydropentalene-3a,6a-dicarboxylate |
| SMILES | COC(=O)[C@]12C=C(OS(=O)(=O)C(F)(F)F)C[C@@]1(C(=O)OC)C=C(OS(=O)(=O)C(F)(F)F)C2 |
| InChI | InChI=1S/C14H12F6O10S2/c1-27-9(21)11-3-7(29-31(23,24)13(15,16)17)5-12(11,10(22)28-2)6-8(4-11)30-32(25,26)14(18,19)20/h3,6H,4-5H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | BLWLFLMMAZLIHV-NEPJUHHUSA-N |
| XLogP | 1.61 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|