C16H21F3O5S — CID 10362472
methyl (1aS,3aR,6aS,6bR)-5,5,6b-trimethyl-2-(trifluoromethylsulfonyloxy)-3a,4,6,6a-tetrahydro-1H-cyclopropa[e]indene-1a-carboxylate (PubChem CID 10362472) has the molecular formula C16H21F3O5S and a molecular weight of 382.40 g/mol. Its IUPAC name is methyl (1aS,3aR,6aS,6bR)-5,5,6b-trimethyl-2-(trifluoromethylsulfonyloxy)-3a,4,6,6a-tetrahydro-1H-cyclopropa[e]indene-1a-carboxylate.
| Compound Name | methyl (1aS,3aR,6aS,6bR)-5,5,6b-trimethyl-2-(trifluoromethylsulfonyloxy)-3a,4,6,6a-tetrahydro-1H-cyclopropa[e]indene-1a-carboxylate |
|---|---|
| PubChem CID | 10362472 |
| Molecular Formula | C16H21F3O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | methyl (1aS,3aR,6aS,6bR)-5,5,6b-trimethyl-2-(trifluoromethylsulfonyloxy)-3a,4,6,6a-tetrahydro-1H-cyclopropa[e]indene-1a-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@]1(C)[C@H]1CC(C)(C)C[C@H]1C=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H21F3O5S/c1-13(2)6-9-5-11(24-25(21,22)16(17,18)19)15(12(20)23-4)8-14(15,3)10(9)7-13/h5,9-10H,6-8H2,1-4H3/t9-,10+,14-,15+/m1/s1 |
| InChIKey | SATKOUSBFCURQP-MMDVMMEASA-N |
| XLogP | 3.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|