C9H11F3O2 — CID 175669281
methyl 3-(trifluoromethyl)bicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 175669281) has the molecular formula C9H11F3O2 and a molecular weight of 208.18 g/mol. Its IUPAC name is methyl 3-(trifluoromethyl)bicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | methyl 3-(trifluoromethyl)bicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 175669281 |
| Molecular Formula | C9H11F3O2 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | methyl 3-(trifluoromethyl)bicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | COC(=O)C1(C(F)(F)F)CC2CC2C1 |
| InChI | InChI=1S/C9H11F3O2/c1-14-7(13)8(9(10,11)12)3-5-2-6(5)4-8/h5-6H,2-4H2,1H3 |
| InChIKey | KNFBNGVCOQQSJN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |