C13H16N2O4 — CID 11076310
dimethyl (1S,2R,4S,5R,6R,8S)-2-methyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarboxylate (PubChem CID 11076310) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is dimethyl (1S,2R,4S,5R,6R,8S)-2-methyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarboxylate.
| Compound Name | dimethyl (1S,2R,4S,5R,6R,8S)-2-methyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarboxylate |
|---|---|
| PubChem CID | 11076310 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | dimethyl (1S,2R,4S,5R,6R,8S)-2-methyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarboxylate |
| SMILES | COC(=O)[C@@]12N=N[C@@](C(=O)OC)([C@H]3C[C@H]31)[C@]1(C)C[C@H]21 |
| InChI | InChI=1S/C13H16N2O4/c1-11-5-8(11)12(9(16)18-2)6-4-7(6)13(11,15-14-12)10(17)19-3/h6-8H,4-5H2,1-3H3/t6-,7+,8+,11-,12-,13-/m1/s1 |
| InChIKey | OJAXWCOHWRRNKI-QWIYAXAXSA-N |
| XLogP | 0.95 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |