C24H22N2O4 — CID 11069454
dimethyl (1S,2S,4R,5R,6R,8S)-2,4-diphenyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarboxylate (PubChem CID 11069454) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is dimethyl (1S,2S,4R,5R,6R,8S)-2,4-diphenyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarboxylate.
| Compound Name | dimethyl (1S,2S,4R,5R,6R,8S)-2,4-diphenyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarboxylate |
|---|---|
| PubChem CID | 11069454 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | dimethyl (1S,2S,4R,5R,6R,8S)-2,4-diphenyl-9,10-diazatetracyclo[3.3.2.02,4.06,8]dec-9-ene-1,5-dicarboxylate |
| SMILES | COC(=O)[C@@]12N=N[C@@](C(=O)OC)([C@H]3C[C@H]31)[C@]1(c3ccccc3)C[C@@]12c1ccccc1 |
| InChI | InChI=1S/C24H22N2O4/c1-29-19(27)23-17-13-18(17)24(26-25-23,20(28)30-2)22(16-11-7-4-8-12-16)14-21(22,23)15-9-5-3-6-10-15/h3-12,17-18H,13-14H2,1-2H3/t17-,18+,21-,22+,23+,24- |
| InChIKey | JBSKLJUKTCERET-CTNSQQCQSA-N |
| XLogP | 3.21 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |