C20H26N2O4 — CID 15419164
dimethyl 15,16-diazahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadec-15-ene-1,8-dicarboxylate (PubChem CID 15419164) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is dimethyl 15,16-diazahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadec-15-ene-1,8-dicarboxylate.
| Compound Name | dimethyl 15,16-diazahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadec-15-ene-1,8-dicarboxylate |
|---|---|
| PubChem CID | 15419164 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | dimethyl 15,16-diazahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadec-15-ene-1,8-dicarboxylate |
| SMILES | COC(=O)C12N=NC(C(=O)OC)(C3C4CCC(C4)C31)C1C3CCC(C3)C12 |
| InChI | InChI=1S/C20H26N2O4/c1-25-17(23)19-13-9-3-5-11(7-9)15(13)20(22-21-19,18(24)26-2)16-12-6-4-10(8-12)14(16)19/h9-16H,3-8H2,1-2H3 |
| InChIKey | IZGKKMFAQYIOGF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |