C11H12O2 — CID 98554819
methyl (1R,2R,3R,6R,7R,8R)-pentacyclo[4.3.0.02,4.03,8.05,7]nonane-4-carboxylate (PubChem CID 98554819) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is methyl (1R,2R,3R,6R,7R,8R)-pentacyclo[4.3.0.02,4.03,8.05,7]nonane-4-carboxylate.
| Compound Name | methyl (1R,2R,3R,6R,7R,8R)-pentacyclo[4.3.0.02,4.03,8.05,7]nonane-4-carboxylate |
|---|---|
| PubChem CID | 98554819 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | methyl (1R,2R,3R,6R,7R,8R)-pentacyclo[4.3.0.02,4.03,8.05,7]nonane-4-carboxylate |
| SMILES | COC(=O)C12C3[C@@H]4[C@H]5C[C@H]([C@@H]34)[C@@H]1[C@@H]52 |
| InChI | InChI=1S/C11H12O2/c1-13-10(12)11-7-3-2-4(8(7)11)6-5(3)9(6)11/h3-9H,2H2,1H3/t3-,4-,5-,6-,7-,8-,9?,11?/m1/s1 |
| InChIKey | ISEFHCPKFWTYCF-FDGGCXEVSA-N |
| XLogP | 0.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |