C10H11NO2 — CID 125041651
methyl (2S,5R,7R,8S)-3-aminocubane-1-carboxylate (PubChem CID 125041651) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is methyl (2S,5R,7R,8S)-3-aminocubane-1-carboxylate.
| Compound Name | methyl (2S,5R,7R,8S)-3-aminocubane-1-carboxylate |
|---|---|
| PubChem CID | 125041651 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | methyl (2S,5R,7R,8S)-3-aminocubane-1-carboxylate |
| SMILES | COC(=O)C12C3[C@@H]4C5[C@@H]3[C@@H]1C5(N)[C@@H]42 |
| InChI | InChI=1S/C10H11NO2/c1-13-8(12)9-4-2-5-3(4)7(9)10(5,11)6(2)9/h2-7H,11H2,1H3/t2-,3-,4?,5?,6+,7+,9?,10?/m1/s1 |
| InChIKey | HVCJUTNLXOJYCO-GKFLVMEFSA-N |
| XLogP | -0.39 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |