C28H26Br2O8 — CID 10628018
dimethyl 8,19-diacetyloxy-9,18-dibromoundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylate (PubChem CID 10628018) has the molecular formula C28H26Br2O8 and a molecular weight of 650.32 g/mol. Its IUPAC name is dimethyl 8,19-diacetyloxy-9,18-dibromoundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylate.
| Compound Name | dimethyl 8,19-diacetyloxy-9,18-dibromoundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylate |
|---|---|
| PubChem CID | 10628018 |
| Molecular Formula | C28H26Br2O8 |
| Molecular Weight | 650.32 g/mol |
| Exact Mass | 648.00 |
| IUPAC Name | dimethyl 8,19-diacetyloxy-9,18-dibromoundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylate |
| SMILES | COC(=O)C12C3C4C5C6C7C8C5C5(OC(C)=O)C9C(C%10C(C89C(=O)OC)C7(Br)C(OC(C)=O)(C63)C%101)C2C45Br |
| InChI | InChI=1S/C28H26Br2O8/c1-5(31)37-27-13-7-8-12-15(13)23(21(33)35-3)18-10-9(19(23)27)17-24(22(34)36-4)16(11(7)25(17,27)29)14(8)28(20(10)24,26(12,18)30)38-6(2)32/h7-20H,1-4H3 |
| InChIKey | HSTZQWDYILALSA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|