C26H28O6 — CID 14381409
dimethyl 11,16-dimethoxyundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylate (PubChem CID 14381409) has the molecular formula C26H28O6 and a molecular weight of 436.50 g/mol. Its IUPAC name is dimethyl 11,16-dimethoxyundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylate.
| Compound Name | dimethyl 11,16-dimethoxyundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylate |
|---|---|
| PubChem CID | 14381409 |
| Molecular Formula | C26H28O6 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | dimethyl 11,16-dimethoxyundecacyclo[9.9.0.02,9.03,7.04,20.05,18.06,16.08,15.010,14.012,19.013,17]icosane-1,6-dicarboxylate |
| SMILES | COC(=O)C12C3C4C5C6C7C8C(C9C%10C8C6(OC)C6(C(=O)OC)C5C3C(C91)C%106)C2(OC)C74 |
| InChI | InChI=1S/C26H28O6/c1-29-21(27)23-13-5-6-14(23)8-10-16(6)24(22(28)30-2)15(5)9-7(13)17-11-12(18(8)25(17,23)31-3)20(10)26(24,32-4)19(9)11/h5-20H,1-4H3 |
| InChIKey | ZRYGHRPFGMGEPA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |