C16H16O6 — CID 98556550
dimethyl (1S,2R,3R,4R,7S,10S)-5,11-dioxopentacyclo[6.4.0.02,10.03,7.04,9]dodecane-8,9-dicarboxylate (PubChem CID 98556550) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is dimethyl (1S,2R,3R,4R,7S,10S)-5,11-dioxopentacyclo[6.4.0.02,10.03,7.04,9]dodecane-8,9-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3R,4R,7S,10S)-5,11-dioxopentacyclo[6.4.0.02,10.03,7.04,9]dodecane-8,9-dicarboxylate |
|---|---|
| PubChem CID | 98556550 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | dimethyl (1S,2R,3R,4R,7S,10S)-5,11-dioxopentacyclo[6.4.0.02,10.03,7.04,9]dodecane-8,9-dicarboxylate |
| SMILES | COC(=O)C12[C@H]3CC(=O)[C@H]4[C@@H]3[C@H]3[C@@H](C(=O)C[C@@H]31)C42C(=O)OC |
| InChI | InChI=1S/C16H16O6/c1-21-13(19)15-5-3-7(17)11-9(5)10-6(15)4-8(18)12(10)16(11,15)14(20)22-2/h5-6,9-12H,3-4H2,1-2H3/t5-,6-,9-,10-,11-,12+,15?,16?/m0/s1 |
| InChIKey | RLINYGBGHUKBFD-RDCQMLSYSA-N |
| XLogP | -0.01 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |