C8H9FO4 — CID 20715391
methyl 6-fluoro-2-hydroxy-4-oxobicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 20715391) has the molecular formula C8H9FO4 and a molecular weight of 188.15 g/mol. Its IUPAC name is methyl 6-fluoro-2-hydroxy-4-oxobicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | methyl 6-fluoro-2-hydroxy-4-oxobicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 20715391 |
| Molecular Formula | C8H9FO4 |
| Molecular Weight | 188.15 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | methyl 6-fluoro-2-hydroxy-4-oxobicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | COC(=O)C1(F)C2C(=O)CC(O)C21 |
| InChI | InChI=1S/C8H9FO4/c1-13-7(12)8(9)5-3(10)2-4(11)6(5)8/h3,5-6,10H,2H2,1H3 |
| InChIKey | BRFFTEZIOUCBJW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.15 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |