C20H28F2O9 — CID 159253524
methyl (1R,2R,4S,5S,6R)-2-butanoyloxy-6-fluoro-4-hydroxybicyclo[3.1.0]hexane-6-carboxylate;methyl (1R,2R,4S,5S)-6-fluoro-2,4-dihydroxybicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 159253524) has the molecular formula C20H28F2O9 and a molecular weight of 450.43 g/mol. Its IUPAC name is methyl (1R,2R,4S,5S,6R)-2-butanoyloxy-6-fluoro-4-hydroxybicyclo[3.1.0]hexane-6-carboxylate;methyl (1R,2R,4S,5S)-6-fluoro-2,4-dihydroxybicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | methyl (1R,2R,4S,5S,6R)-2-butanoyloxy-6-fluoro-4-hydroxybicyclo[3.1.0]hexane-6-carboxylate;methyl (1R,2R,4S,5S)-6-fluoro-2,4-dihydroxybicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 159253524 |
| Molecular Formula | C20H28F2O9 |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | methyl (1R,2R,4S,5S,6R)-2-butanoyloxy-6-fluoro-4-hydroxybicyclo[3.1.0]hexane-6-carboxylate;methyl (1R,2R,4S,5S)-6-fluoro-2,4-dihydroxybicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CCCC(=O)O[C@@H]1C[C@H](O)[C@@H]2[C@H]1[C@@]2(F)C(=O)OC.COC(=O)C1(F)[C@@H]2[C@H]1[C@@H](O)C[C@H]2O |
| InChI | InChI=1S/C12H17FO5.C8H11FO4/c1-3-4-8(15)18-7-5-6(14)9-10(7)12(9,13)11(16)17-2;1-13-7(12)8(9)5-3(10)2-4(11)6(5)8/h6-7,9-10,14H,3-5H2,1-2H3;3-6,10-11H,2H2,1H3/t6-,7+,9+,10-,12+;3-,4+,5+,6-,8?/m0./s1 |
| InChIKey | KVPHPNHRQCMRMS-NXOMYTBUSA-N |
| XLogP | -0.17 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|