C13H20O4 — CID 14290500
[(1S,2S,4S)-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl] butanoate (PubChem CID 14290500) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is [(1S,2S,4S)-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl] butanoate.
| Compound Name | [(1S,2S,4S)-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl] butanoate |
|---|---|
| PubChem CID | 14290500 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [(1S,2S,4S)-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C[C@H]2C=C[C@@H]1C2(OC)OC |
| InChI | InChI=1S/C13H20O4/c1-4-5-12(14)17-11-8-9-6-7-10(11)13(9,15-2)16-3/h6-7,9-11H,4-5,8H2,1-3H3/t9-,10+,11+/m1/s1 |
| InChIKey | RYQMYRNGQPOCPZ-VWYCJHECSA-N |
| XLogP | 1.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|