C11H20O7 — CID 10587673
[(1S,2R,3S,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-methoxycyclohexyl] butanoate (PubChem CID 10587673) has the molecular formula C11H20O7 and a molecular weight of 264.27 g/mol. Its IUPAC name is [(1S,2R,3S,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-methoxycyclohexyl] butanoate.
| Compound Name | [(1S,2R,3S,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-methoxycyclohexyl] butanoate |
|---|---|
| PubChem CID | 10587673 |
| Molecular Formula | C11H20O7 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | [(1S,2R,3S,4S,5R,6R)-2,3,4,5-tetrahydroxy-6-methoxycyclohexyl] butanoate |
| SMILES | CCCC(=O)O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1OC |
| InChI | InChI=1S/C11H20O7/c1-3-4-5(12)18-11-9(16)7(14)6(13)8(15)10(11)17-2/h6-11,13-16H,3-4H2,1-2H3/t6-,7-,8+,9+,10+,11-/m0/s1 |
| InChIKey | JDJPJIQOQZPYDS-LVGGVBNSSA-N |
| XLogP | -1.83 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |