C9H18O6 — CID 68728955
(1R,3R,4R,6S)-4,5,6-trimethoxycyclohexane-1,2,3-triol (PubChem CID 68728955) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (1R,3R,4R,6S)-4,5,6-trimethoxycyclohexane-1,2,3-triol.
| Compound Name | (1R,3R,4R,6S)-4,5,6-trimethoxycyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 68728955 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (1R,3R,4R,6S)-4,5,6-trimethoxycyclohexane-1,2,3-triol |
| SMILES | COC1[C@@H](OC)[C@H](O)C(O)[C@@H](O)[C@H]1OC |
| InChI | InChI=1S/C9H18O6/c1-13-7-5(11)4(10)6(12)8(14-2)9(7)15-3/h4-12H,1-3H3/t4?,5-,6-,7-,8+,9?/m1/s1 |
| InChIKey | SYBOAVPAUNFUFI-JPVZBJKMSA-N |
| XLogP | -1.87 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |