C8H16O8S — CID 101098069
[(1S,2S,3R,4R,5S,6S)-2,3,4,6-tetrahydroxy-5-methoxycyclohexyl] methanesulfonate (PubChem CID 101098069) has the molecular formula C8H16O8S and a molecular weight of 272.28 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5S,6S)-2,3,4,6-tetrahydroxy-5-methoxycyclohexyl] methanesulfonate.
| Compound Name | [(1S,2S,3R,4R,5S,6S)-2,3,4,6-tetrahydroxy-5-methoxycyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 101098069 |
| Molecular Formula | C8H16O8S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | [(1S,2S,3R,4R,5S,6S)-2,3,4,6-tetrahydroxy-5-methoxycyclohexyl] methanesulfonate |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](OS(C)(=O)=O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H16O8S/c1-15-7-4(10)3(9)5(11)8(6(7)12)16-17(2,13)14/h3-12H,1-2H3/t3-,4-,5+,6+,7+,8+/m1/s1 |
| InChIKey | OLMVXZMBGRWACY-LVTNRUAJSA-N |
| XLogP | -3.20 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|