C8H12Na2O10S — CID 102278158
disodium;(2R,3S,4S,5R,6R)-4-hydroxy-3,6-dimethoxy-5-sulfonatooxyoxane-2-carboxylate (PubChem CID 102278158) has the molecular formula C8H12Na2O10S and a molecular weight of 346.22 g/mol. Its IUPAC name is disodium;(2R,3S,4S,5R,6R)-4-hydroxy-3,6-dimethoxy-5-sulfonatooxyoxane-2-carboxylate.
| Compound Name | disodium;(2R,3S,4S,5R,6R)-4-hydroxy-3,6-dimethoxy-5-sulfonatooxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 102278158 |
| Molecular Formula | C8H12Na2O10S |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | disodium;(2R,3S,4S,5R,6R)-4-hydroxy-3,6-dimethoxy-5-sulfonatooxyoxane-2-carboxylate |
| SMILES | CO[C@@H]1O[C@@H](C(=O)[O-])[C@@H](OC)[C@H](O)[C@H]1OS(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H14O10S.2Na/c1-15-4-3(9)5(18-19(12,13)14)8(16-2)17-6(4)7(10)11;;/h3-6,8-9H,1-2H3,(H,10,11)(H,12,13,14);;/q;2*+1/p-2/t3-,4-,5+,6+,8+;;/m0../s1 |
| InChIKey | ZZJBHOGOSZKIBO-NVNVNLEJSA-L |
| XLogP | -9.66 |
| TPSA | 154.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | -9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|