C7H11KO7 — CID 154734807
potassium (2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxane-2-carboxylate (PubChem CID 154734807) has the molecular formula C7H11KO7 and a molecular weight of 246.26 g/mol. Its IUPAC name is potassium (2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxane-2-carboxylate.
| Compound Name | potassium (2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 154734807 |
| Molecular Formula | C7H11KO7 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | potassium (2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxane-2-carboxylate |
| SMILES | CO[C@H]1O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@@H]1O.[K+] |
| InChI | InChI=1S/C7H12O7.K/c1-13-7-4(10)2(8)3(9)5(14-7)6(11)12;/h2-5,7-10H,1H3,(H,11,12);/q;+1/p-1/t2-,3-,4-,5-,7-;/m0./s1 |
| InChIKey | DVSWSYLRNRUCJS-FYXLXHTJSA-M |
| XLogP | -6.81 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |