C6H9NaO7 — CID 23664051
sodium (2S,3R,4R,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 23664051) has the molecular formula C6H9NaO7 and a molecular weight of 216.12 g/mol. Its IUPAC name is sodium (2S,3R,4R,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | sodium (2S,3R,4R,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 23664051 |
| Molecular Formula | C6H9NaO7 |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | sodium (2S,3R,4R,5R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | O=C([O-])[C@H]1OC(O)[C@H](O)[C@H](O)[C@H]1O.[Na+] |
| InChI | InChI=1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1/t1-,2-,3-,4+,6?;/m1./s1 |
| InChIKey | MSXHSNHNTORCAW-OVRDBETASA-M |
| XLogP | -7.46 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | -7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |