C7H12O6 — CID 91170856
1-[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]ethanone (PubChem CID 91170856) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is 1-[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]ethanone.
| Compound Name | 1-[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 91170856 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 1-[(3S,4S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]ethanone |
| SMILES | CC(=O)C1O[C@H](O)C(O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H12O6/c1-2(8)6-4(10)3(9)5(11)7(12)13-6/h3-7,9-12H,1H3/t3-,4-,5?,6?,7-/m0/s1 |
| InChIKey | ZXTKSWFCRRTTMN-PGCBPSKHSA-N |
| XLogP | -2.62 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |