C8H12O8 — CID 140603541
acetyl (2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 140603541) has the molecular formula C8H12O8 and a molecular weight of 236.18 g/mol. Its IUPAC name is acetyl (2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | acetyl (2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 140603541 |
| Molecular Formula | C8H12O8 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | acetyl (2R,3S,4S,5R,6S)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | CC(=O)OC(=O)[C@@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H12O8/c1-2(9)15-8(14)6-4(11)3(10)5(12)7(13)16-6/h3-7,10-13H,1H3/t3-,4-,5+,6+,7-/m0/s1 |
| InChIKey | TXJOMRZCECVXJE-TYDWOXHJSA-N |
| XLogP | -3.12 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|