C9H12O7 — CID 87621206
prop-2-ynyl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 87621206) has the molecular formula C9H12O7 and a molecular weight of 232.19 g/mol. Its IUPAC name is prop-2-ynyl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | prop-2-ynyl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 87621206 |
| Molecular Formula | C9H12O7 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | prop-2-ynyl (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | C#CCOC(=O)[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H12O7/c1-2-3-15-9(14)7-5(11)4(10)6(12)8(13)16-7/h1,4-8,10-13H,3H2/t4-,5-,6+,7-,8+/m0/s1 |
| InChIKey | FTJCOYULZPYOOC-YOWKYNACSA-N |
| XLogP | -3.04 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|