C9H14O6 — CID 87171059
(3R,4S,5R,6R)-6-(prop-2-ynoxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 87171059) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-(prop-2-ynoxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3R,4S,5R,6R)-6-(prop-2-ynoxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 87171059 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (3R,4S,5R,6R)-6-(prop-2-ynoxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | C#CCOC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H14O6/c1-2-3-14-4-5-6(10)7(11)8(12)9(13)15-5/h1,5-13H,3-4H2/t5-,6+,7+,8-,9?/m1/s1 |
| InChIKey | YTECGXSBXITWBL-MBOVONDJSA-N |
| XLogP | -2.56 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|