C10H20O6 — CID 90907126
6-[(2-methylpropan-2-yl)oxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 90907126) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is 6-[(2-methylpropan-2-yl)oxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | 6-[(2-methylpropan-2-yl)oxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 90907126 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 6-[(2-methylpropan-2-yl)oxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | CC(C)(C)OCC1OC(O)C(O)C(O)C1O |
| InChI | InChI=1S/C10H20O6/c1-10(2,3)15-4-5-6(11)7(12)8(13)9(14)16-5/h5-9,11-14H,4H2,1-3H3 |
| InChIKey | FFYOAZAPMNFPSJ-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |