C6H12O5S — CID 69405566
(2S,3R,4R,5R)-5-(methylsulfanyloxymethyl)oxolane-2,3,4-triol (PubChem CID 69405566) has the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-(methylsulfanyloxymethyl)oxolane-2,3,4-triol.
| Compound Name | (2S,3R,4R,5R)-5-(methylsulfanyloxymethyl)oxolane-2,3,4-triol |
|---|---|
| PubChem CID | 69405566 |
| Molecular Formula | C6H12O5S |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | (2S,3R,4R,5R)-5-(methylsulfanyloxymethyl)oxolane-2,3,4-triol |
| SMILES | CSOC[C@H]1O[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O5S/c1-12-10-2-3-4(7)5(8)6(9)11-3/h3-9H,2H2,1H3/t3-,4+,5-,6+/m1/s1 |
| InChIKey | AIEQYALXIXZGAS-MOJAZDJTSA-N |
| XLogP | -1.28 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|