C11H8O7 — CID 122636053
bis(prop-2-ynyl) 2-oxo-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 122636053) has the molecular formula C11H8O7 and a molecular weight of 252.18 g/mol. Its IUPAC name is bis(prop-2-ynyl) 2-oxo-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | bis(prop-2-ynyl) 2-oxo-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 122636053 |
| Molecular Formula | C11H8O7 |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | bis(prop-2-ynyl) 2-oxo-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | C#CCOC(=O)C1OC(=O)OC1C(=O)OCC#C |
| InChI | InChI=1S/C11H8O7/c1-3-5-15-9(12)7-8(18-11(14)17-7)10(13)16-6-4-2/h1-2,7-8H,5-6H2 |
| InChIKey | AXHDGCCPXNNQED-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|