C11H12O6 — CID 138700691
5-O-prop-2-enyl 4-O-prop-2-ynyl 1,3-dioxolane-4,5-dicarboxylate (PubChem CID 138700691) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is 5-O-prop-2-enyl 4-O-prop-2-ynyl 1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | 5-O-prop-2-enyl 4-O-prop-2-ynyl 1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 138700691 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 5-O-prop-2-enyl 4-O-prop-2-ynyl 1,3-dioxolane-4,5-dicarboxylate |
| SMILES | C#CCOC(=O)C1OCOC1C(=O)OCC=C |
| InChI | InChI=1S/C11H12O6/c1-3-5-14-10(12)8-9(17-7-16-8)11(13)15-6-4-2/h1,4,8-9H,2,5-7H2 |
| InChIKey | PFLAEDHVMQLXAG-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|