C7H10O6S — CID 134599801
prop-2-enyl 5-methyl-2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate (PubChem CID 134599801) has the molecular formula C7H10O6S and a molecular weight of 222.22 g/mol. Its IUPAC name is prop-2-enyl 5-methyl-2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate.
| Compound Name | prop-2-enyl 5-methyl-2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate |
|---|---|
| PubChem CID | 134599801 |
| Molecular Formula | C7H10O6S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | prop-2-enyl 5-methyl-2,2-dioxo-1,3,2-dioxathiolane-4-carboxylate |
| SMILES | C=CCOC(=O)C1OS(=O)(=O)OC1C |
| InChI | InChI=1S/C7H10O6S/c1-3-4-11-7(8)6-5(2)12-14(9,10)13-6/h3,5-6H,1,4H2,2H3 |
| InChIKey | HRSSBSOGHLGMCA-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|