C9H12O4 — CID 102356998
prop-2-enyl (2R)-3,3-dimethyl-4-oxooxetane-2-carboxylate (PubChem CID 102356998) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is prop-2-enyl (2R)-3,3-dimethyl-4-oxooxetane-2-carboxylate.
| Compound Name | prop-2-enyl (2R)-3,3-dimethyl-4-oxooxetane-2-carboxylate |
|---|---|
| PubChem CID | 102356998 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | prop-2-enyl (2R)-3,3-dimethyl-4-oxooxetane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1OC(=O)C1(C)C |
| InChI | InChI=1S/C9H12O4/c1-4-5-12-7(10)6-9(2,3)8(11)13-6/h4,6H,1,5H2,2-3H3/t6-/m0/s1 |
| InChIKey | RFKINEIMZHWWPZ-LURJTMIESA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|