C9H8O5 — CID 122643653
prop-2-ynyl 5-ethenyl-2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 122643653) has the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. Its IUPAC name is prop-2-ynyl 5-ethenyl-2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | prop-2-ynyl 5-ethenyl-2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 122643653 |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | prop-2-ynyl 5-ethenyl-2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | C#CCOC(=O)C1OC(=O)OC1C=C |
| InChI | InChI=1S/C9H8O5/c1-3-5-12-8(10)7-6(4-2)13-9(11)14-7/h1,4,6-7H,2,5H2 |
| InChIKey | UOOAACBFDNCJHP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|