C8H12NO7- — CID 154586187
(2S,3S,4R,5S,6R)-5-acetamido-3,4,6-trihydroxyoxane-2-carboxylate (PubChem CID 154586187) has the molecular formula C8H12NO7- and a molecular weight of 234.18 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-5-acetamido-3,4,6-trihydroxyoxane-2-carboxylate.
| Compound Name | (2S,3S,4R,5S,6R)-5-acetamido-3,4,6-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 154586187 |
| Molecular Formula | C8H12NO7- |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (2S,3S,4R,5S,6R)-5-acetamido-3,4,6-trihydroxyoxane-2-carboxylate |
| SMILES | CC(=O)N[C@H]1[C@@H](O)[C@H](O)[C@@H](C(=O)[O-])O[C@H]1O |
| InChI | InChI=1S/C8H13NO7/c1-2(10)9-3-4(11)5(12)6(7(13)14)16-8(3)15/h3-6,8,11-12,15H,1H3,(H,9,10)(H,13,14)/p-1/t3-,4+,5-,6-,8+/m0/s1 |
| InChIKey | KSOXQRPSZKLEOR-YMPULBMMSA-M |
| XLogP | -4.32 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |