C4H2Na2O5 — CID 100992139
disodium;(2S,3S)-oxirane-2,3-dicarboxylate (PubChem CID 100992139) has the molecular formula C4H2Na2O5 and a molecular weight of 176.03 g/mol. Its IUPAC name is disodium;(2S,3S)-oxirane-2,3-dicarboxylate.
| Compound Name | disodium;(2S,3S)-oxirane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 100992139 |
| Molecular Formula | C4H2Na2O5 |
| Molecular Weight | 176.03 g/mol |
| Exact Mass | 175.97 |
| IUPAC Name | disodium;(2S,3S)-oxirane-2,3-dicarboxylate |
| SMILES | O=C([O-])[C@H]1O[C@@H]1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C4H4O5.2Na/c5-3(6)1-2(9-1)4(7)8;;/h1-2H,(H,5,6)(H,7,8);;/q;2*+1/p-2/t1-,2-;;/m0../s1 |
| InChIKey | BOOBCDRJMPBXQP-OTWIGTIJSA-L |
| XLogP | -9.74 |
| TPSA | 92.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.03 |
| LogP ≤ 5 | -9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|