About barium(2+);oxirane-2,3-dicarboxylate
barium(2+);oxirane-2,3-dicarboxylate (PubChem CID 171036812) has the molecular formula C4H2BaO5
and a molecular weight of 267.38 g/mol. Its IUPAC name is barium(2+);oxirane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | barium(2+);oxirane-2,3-dicarboxylate |
| PubChem CID | 171036812 |
| Molecular Formula | C4H2BaO5 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.90 |
| IUPAC Name | barium(2+);oxirane-2,3-dicarboxylate |
| SMILES | O=C([O-])C1OC1C(=O)[O-].[Ba+2] |
| InChI | InChI=1S/C4H4O5.Ba/c5-3(6)1-2(9-1)4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2 |
| InChIKey | OCTAFAUQSARSPC-UHFFFAOYSA-L |
| XLogP | -4.13 |
| TPSA | 92.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);oxirane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);oxirane-2,3-dicarboxylate?
The IUPAC name of barium(2+);oxirane-2,3-dicarboxylate (CID 171036812) is barium(2+);oxirane-2,3-dicarboxylate.
What is the SMILES notation for barium(2+);oxirane-2,3-dicarboxylate?
The canonical SMILES for barium(2+);oxirane-2,3-dicarboxylate is O=C([O-])C1OC1C(=O)[O-].[Ba+2].
What is the InChIKey of barium(2+);oxirane-2,3-dicarboxylate?
The InChIKey is OCTAFAUQSARSPC-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H4O5.Ba/c5-3(6)1-2(9-1)4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+2/p-2.
What are the key properties of barium(2+);oxirane-2,3-dicarboxylate?
barium(2+);oxirane-2,3-dicarboxylate has a molecular weight of 267.38 g/mol, XLogP of -4.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);oxirane-2,3-dicarboxylate is sourced from PubChem (CID 171036812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).