C8H6CaO10 — CID 88800397
calcium bis((2R,3S)-3-carboxyoxirane-2-carboxylate) (PubChem CID 88800397) has the molecular formula C8H6CaO10 and a molecular weight of 302.20 g/mol. Its IUPAC name is calcium bis((2R,3S)-3-carboxyoxirane-2-carboxylate).
| Compound Name | calcium bis((2R,3S)-3-carboxyoxirane-2-carboxylate) |
|---|---|
| PubChem CID | 88800397 |
| Molecular Formula | C8H6CaO10 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.96 |
| IUPAC Name | calcium bis((2R,3S)-3-carboxyoxirane-2-carboxylate) |
| SMILES | O=C(O)[C@H]1O[C@H]1C(=O)[O-].O=C(O)[C@H]1O[C@H]1C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C4H4O5.Ca/c2*5-3(6)1-2(9-1)4(7)8;/h2*1-2H,(H,5,6)(H,7,8);/q;;+2/p-2/t2*1-,2+; |
| InChIKey | HMXXNLMGTFQIQN-LDGNHRKUSA-L |
| XLogP | -5.20 |
| TPSA | 179.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | -5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|