C8H12Cl4O9 — CID 66750488
oxolane-2,3,4,5-tetracarboxylic acid;tetrahydrochloride (PubChem CID 66750488) has the molecular formula C8H12Cl4O9 and a molecular weight of 393.99 g/mol. Its IUPAC name is oxolane-2,3,4,5-tetracarboxylic acid;tetrahydrochloride.
| Compound Name | oxolane-2,3,4,5-tetracarboxylic acid;tetrahydrochloride |
|---|---|
| PubChem CID | 66750488 |
| Molecular Formula | C8H12Cl4O9 |
| Molecular Weight | 393.99 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | oxolane-2,3,4,5-tetracarboxylic acid;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.O=C(O)C1OC(C(=O)O)C(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C8H8O9.4ClH/c9-5(10)1-2(6(11)12)4(8(15)16)17-3(1)7(13)14;;;;/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16);4*1H |
| InChIKey | UBHRVFJFOSNSBK-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.99 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |