C9H17NO6 — CID 22215484
(2S,3S,4S,5R,6S)-4-hydroxy-3,5,6-trimethoxyoxane-2-carboxamide (PubChem CID 22215484) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-4-hydroxy-3,5,6-trimethoxyoxane-2-carboxamide.
| Compound Name | (2S,3S,4S,5R,6S)-4-hydroxy-3,5,6-trimethoxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 22215484 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (2S,3S,4S,5R,6S)-4-hydroxy-3,5,6-trimethoxyoxane-2-carboxamide |
| SMILES | CO[C@H]1O[C@H](C(N)=O)[C@@H](OC)[C@H](O)[C@H]1OC |
| InChI | InChI=1S/C9H17NO6/c1-13-5-4(11)6(14-2)9(15-3)16-7(5)8(10)12/h4-7,9,11H,1-3H3,(H2,10,12)/t4-,5-,6+,7-,9-/m0/s1 |
| InChIKey | RSHVNMNYUREWOW-MNDKRXPHSA-N |
| XLogP | -1.77 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |