4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid

C7H13NO7 — CID 145317527

IUPAC4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid
SMILESCOC1OC(C(=O)O)C(O)C(ON)C1O
InChIInChI=1S/C7H13NO7/c1-13-7-3(10)4(15-8)2(9)5(14-7)6(11)12/h2-5,7,9-10H,8H2,1H3,(H,11,12)
InChIKeySKMQAYWDYVLNPR-UHFFFAOYSA-N
MW223.18 g/mol
LogP-2.58
Rot. Bonds3

About 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid

4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid (PubChem CID 145317527) has the molecular formula C7H13NO7 and a molecular weight of 223.18 g/mol. Its IUPAC name is 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid.

Molecular Properties

Compound Name4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid
PubChem CID145317527
Molecular FormulaC7H13NO7
Molecular Weight223.18 g/mol
Exact Mass223.07
IUPAC Name4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid
SMILESCOC1OC(C(=O)O)C(O)C(ON)C1O
InChIInChI=1S/C7H13NO7/c1-13-7-3(10)4(15-8)2(9)5(14-7)6(11)12/h2-5,7,9-10H,8H2,1H3,(H,11,12)
InChIKeySKMQAYWDYVLNPR-UHFFFAOYSA-N
XLogP-2.58
TPSA131.47 Ų
H-Bond Donors4
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.18
LogP ≤ 5-2.58
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid?
The IUPAC name of 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid (CID 145317527) is 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid.
What is the SMILES notation for 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid?
The canonical SMILES for 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid is COC1OC(C(=O)O)C(O)C(ON)C1O.
What is the InChIKey of 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid?
The InChIKey is SKMQAYWDYVLNPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO7/c1-13-7-3(10)4(15-8)2(9)5(14-7)6(11)12/h2-5,7,9-10H,8H2,1H3,(H,11,12).
What are the key properties of 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid?
4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid has a molecular weight of 223.18 g/mol, XLogP of -2.58, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid is sourced from PubChem (CID 145317527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).