C9H19NO7 — CID 145317526
4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid;ethane (PubChem CID 145317526) has the molecular formula C9H19NO7 and a molecular weight of 253.25 g/mol. Its IUPAC name is 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid;ethane.
| Compound Name | 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145317526 |
| Molecular Formula | C9H19NO7 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-aminooxy-3,5-dihydroxy-6-methoxyoxane-2-carboxylic acid;ethane |
| SMILES | CC.COC1OC(C(=O)O)C(O)C(ON)C1O |
| InChI | InChI=1S/C7H13NO7.C2H6/c1-13-7-3(10)4(15-8)2(9)5(14-7)6(11)12;1-2/h2-5,7,9-10H,8H2,1H3,(H,11,12);1-2H3 |
| InChIKey | CHMPSBGMIDBFLG-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|