C7H13NO5 — CID 14139997
4-amino-5-hydroxy-6-methoxyoxane-2-carboxylic acid (PubChem CID 14139997) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is 4-amino-5-hydroxy-6-methoxyoxane-2-carboxylic acid.
| Compound Name | 4-amino-5-hydroxy-6-methoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 14139997 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 4-amino-5-hydroxy-6-methoxyoxane-2-carboxylic acid |
| SMILES | COC1OC(C(=O)O)CC(N)C1O |
| InChI | InChI=1S/C7H13NO5/c1-12-7-5(9)3(8)2-4(13-7)6(10)11/h3-5,7,9H,2,8H2,1H3,(H,10,11) |
| InChIKey | YUHRIPHWFPBUFJ-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |