About methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate
methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate (PubChem CID 67990824) has the molecular formula C9H16O6
and a molecular weight of 220.22 g/mol. Its IUPAC name is methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate |
| PubChem CID | 67990824 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate |
| SMILES | COC(=O)CC1CC(O)C(O)C(OC)O1 |
| InChI | InChI=1S/C9H16O6/c1-13-7(11)4-5-3-6(10)8(12)9(14-2)15-5/h5-6,8-10,12H,3-4H2,1-2H3 |
| InChIKey | UUCFBAIQXDXDRN-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate?
The IUPAC name of methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate (CID 67990824) is methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate.
What is the SMILES notation for methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate?
The canonical SMILES for methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate is COC(=O)CC1CC(O)C(O)C(OC)O1.
What is the InChIKey of methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate?
The InChIKey is UUCFBAIQXDXDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O6/c1-13-7(11)4-5-3-6(10)8(12)9(14-2)15-5/h5-6,8-10,12H,3-4H2,1-2H3.
What are the key properties of methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate?
methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate has a molecular weight of 220.22 g/mol, XLogP of -0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,5-dihydroxy-6-methoxyoxan-2-yl)acetate is sourced from PubChem (CID 67990824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).