About 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane
6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane (PubChem CID 142004285) has the molecular formula C9H21NO4
and a molecular weight of 207.27 g/mol. Its IUPAC name is 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane.
Molecular Properties
| Compound Name | 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane |
| PubChem CID | 142004285 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane |
| SMILES | CC.COC1OC(CN)CC(O)C1O |
| InChI | InChI=1S/C7H15NO4.C2H6/c1-11-7-6(10)5(9)2-4(3-8)12-7;1-2/h4-7,9-10H,2-3,8H2,1H3;1-2H3 |
| InChIKey | PXRNKPWCLZWKJI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane?
The IUPAC name of 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane (CID 142004285) is 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane.
What is the SMILES notation for 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane?
The canonical SMILES for 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane is CC.COC1OC(CN)CC(O)C1O.
What is the InChIKey of 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane?
The InChIKey is PXRNKPWCLZWKJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO4.C2H6/c1-11-7-6(10)5(9)2-4(3-8)12-7;1-2/h4-7,9-10H,2-3,8H2,1H3;1-2H3.
What are the key properties of 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane?
6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane has a molecular weight of 207.27 g/mol, XLogP of -0.55, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane is sourced from PubChem (CID 142004285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).