C9H21NO4 — CID 142004285
6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane (PubChem CID 142004285) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane.
| Compound Name | 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane |
|---|---|
| PubChem CID | 142004285 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 6-(aminomethyl)-2-methoxyoxane-3,4-diol;ethane |
| SMILES | CC.COC1OC(CN)CC(O)C1O |
| InChI | InChI=1S/C7H15NO4.C2H6/c1-11-7-6(10)5(9)2-4(3-8)12-7;1-2/h4-7,9-10H,2-3,8H2,1H3;1-2H3 |
| InChIKey | PXRNKPWCLZWKJI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |