C7H16ClNO5 — CID 131842478
(2R,3R,4S,5R,6S)-2-(aminomethyl)-6-methoxyoxane-3,4,5-triol;hydrochloride (PubChem CID 131842478) has the molecular formula C7H16ClNO5 and a molecular weight of 229.66 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(aminomethyl)-6-methoxyoxane-3,4,5-triol;hydrochloride.
| Compound Name | (2R,3R,4S,5R,6S)-2-(aminomethyl)-6-methoxyoxane-3,4,5-triol;hydrochloride |
|---|---|
| PubChem CID | 131842478 |
| Molecular Formula | C7H16ClNO5 |
| Molecular Weight | 229.66 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(aminomethyl)-6-methoxyoxane-3,4,5-triol;hydrochloride |
| SMILES | CO[C@H]1O[C@H](CN)[C@H](O)[C@H](O)[C@H]1O.Cl |
| InChI | InChI=1S/C7H15NO5.ClH/c1-12-7-6(11)5(10)4(9)3(2-8)13-7;/h3-7,9-11H,2,8H2,1H3;1H/t3-,4+,5+,6-,7+;/m1./s1 |
| InChIKey | GFQAHWOAVJXCGH-SAPZPLNPSA-N |
| XLogP | -2.18 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.66 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |