About methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate
methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate (PubChem CID 11105849) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate.
Analyze methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate?
The IUPAC name of methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate (CID 11105849) is methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate.
What is the SMILES notation for methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate?
The canonical SMILES for methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate is COC(=O)C[C@H]1C[C@H](O)[C@@H](C)O1.
What is the InChIKey of methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate?
The InChIKey is JEECSZMLPJNGNN-QYNIQEEDSA-N. The full InChI is InChI=1S/C8H14O4/c1-5-7(9)3-6(12-5)4-8(10)11-2/h5-7,9H,3-4H2,1-2H3/t5-,6-,7+/m1/s1.
What are the key properties of methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate?
methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate has a molecular weight of 174.20 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2R,4S,5R)-4-hydroxy-5-methyloxolan-2-yl]acetate is sourced from PubChem (CID 11105849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).