C15H24O6 — CID 162397869
methyl (Z)-3-[(2R,3R,4S,6R)-6-(2-ethoxy-2-oxoethyl)-4-hydroxy-3-methyloxan-2-yl]-2-methylprop-2-enoate (PubChem CID 162397869) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is methyl (Z)-3-[(2R,3R,4S,6R)-6-(2-ethoxy-2-oxoethyl)-4-hydroxy-3-methyloxan-2-yl]-2-methylprop-2-enoate.
| Compound Name | methyl (Z)-3-[(2R,3R,4S,6R)-6-(2-ethoxy-2-oxoethyl)-4-hydroxy-3-methyloxan-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162397869 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | methyl (Z)-3-[(2R,3R,4S,6R)-6-(2-ethoxy-2-oxoethyl)-4-hydroxy-3-methyloxan-2-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C[C@H]1C[C@H](O)[C@@H](C)[C@@H](/C=C(/C)C(=O)OC)O1 |
| InChI | InChI=1S/C15H24O6/c1-5-20-14(17)8-11-7-12(16)10(3)13(21-11)6-9(2)15(18)19-4/h6,10-13,16H,5,7-8H2,1-4H3/b9-6-/t10-,11-,12+,13-/m1/s1 |
| InChIKey | RYTKAYNTJKTPEF-FAVPBMAVSA-N |
| XLogP | 1.21 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|