C21H30O6 — CID 10883378
ethyl (Z)-3-[(2S,3S,4R,6S)-6-methoxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]-2-methylprop-2-enoate (PubChem CID 10883378) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl (Z)-3-[(2S,3S,4R,6S)-6-methoxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (Z)-3-[(2S,3S,4R,6S)-6-methoxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 10883378 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | ethyl (Z)-3-[(2S,3S,4R,6S)-6-methoxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxan-2-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C\[C@@H]1O[C@H](OC)C[C@@H](OCc2ccc(OC)cc2)[C@@H]1C |
| InChI | InChI=1S/C21H30O6/c1-6-25-21(22)14(2)11-19-15(3)18(12-20(24-5)27-19)26-13-16-7-9-17(23-4)10-8-16/h7-11,15,18-20H,6,12-13H2,1-5H3/b14-11-/t15-,18+,19-,20-/m0/s1 |
| InChIKey | YMRAJLVGROKVHE-GZSHAJSGSA-N |
| XLogP | 3.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|