C22H32O6 — CID 11176826
ethyl 2-[(2S,4S,5R,6S)-6-[(2R)-but-3-en-2-yl]-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-5-methyloxan-2-yl]acetate (PubChem CID 11176826) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is ethyl 2-[(2S,4S,5R,6S)-6-[(2R)-but-3-en-2-yl]-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-5-methyloxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,4S,5R,6S)-6-[(2R)-but-3-en-2-yl]-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-5-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 11176826 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | ethyl 2-[(2S,4S,5R,6S)-6-[(2R)-but-3-en-2-yl]-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-5-methyloxan-2-yl]acetate |
| SMILES | C=C[C@@H](C)[C@@H]1O[C@](O)(CC(=O)OCC)C[C@H](OCc2ccc(OC)cc2)[C@H]1C |
| InChI | InChI=1S/C22H32O6/c1-6-15(3)21-16(4)19(12-22(24,28-21)13-20(23)26-7-2)27-14-17-8-10-18(25-5)11-9-17/h6,8-11,15-16,19,21,24H,1,7,12-14H2,2-5H3/t15-,16-,19+,21+,22+/m1/s1 |
| InChIKey | GRSBZMOATWUQEQ-XQAUGQPQSA-N |
| XLogP | 3.47 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|