C16H23IO4 — CID 10835153
(2R,3R,4S,6S)-6-(iodomethyl)-2-methoxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxane (PubChem CID 10835153) has the molecular formula C16H23IO4 and a molecular weight of 406.26 g/mol. Its IUPAC name is (2R,3R,4S,6S)-6-(iodomethyl)-2-methoxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxane.
| Compound Name | (2R,3R,4S,6S)-6-(iodomethyl)-2-methoxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxane |
|---|---|
| PubChem CID | 10835153 |
| Molecular Formula | C16H23IO4 |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | (2R,3R,4S,6S)-6-(iodomethyl)-2-methoxy-4-[(4-methoxyphenyl)methoxy]-3-methyloxane |
| SMILES | COc1ccc(CO[C@H]2C[C@@H](CI)O[C@@H](OC)[C@@H]2C)cc1 |
| InChI | InChI=1S/C16H23IO4/c1-11-15(8-14(9-17)21-16(11)19-3)20-10-12-4-6-13(18-2)7-5-12/h4-7,11,14-16H,8-10H2,1-3H3/t11-,14+,15+,16-/m1/s1 |
| InChIKey | FPLSWCPTJMHMTK-IPOQPSJVSA-N |
| XLogP | 3.41 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|