C26H42O5Si — CID 10695384
ethyl (Z)-3-[(2R,3R,4S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-4-phenylmethoxyoxan-2-yl]-2-methylprop-2-enoate (PubChem CID 10695384) has the molecular formula C26H42O5Si and a molecular weight of 462.70 g/mol. Its IUPAC name is ethyl (Z)-3-[(2R,3R,4S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-4-phenylmethoxyoxan-2-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (Z)-3-[(2R,3R,4S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-4-phenylmethoxyoxan-2-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 10695384 |
| Molecular Formula | C26H42O5Si |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | ethyl (Z)-3-[(2R,3R,4S,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-4-phenylmethoxyoxan-2-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C\[C@H]1O[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@H](OCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C26H42O5Si/c1-9-28-25(27)19(2)15-24-20(3)23(29-17-21-13-11-10-12-14-21)16-22(31-24)18-30-32(7,8)26(4,5)6/h10-15,20,22-24H,9,16-18H2,1-8H3/b19-15-/t20-,22-,23+,24-/m1/s1 |
| InChIKey | GDTOTDWLPNLQOF-SPSROHGTSA-N |
| XLogP | 5.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|