C19H26O6 — CID 11393976
methyl (E)-4-[(2S,4R)-6-methoxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]but-2-enoate (PubChem CID 11393976) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is methyl (E)-4-[(2S,4R)-6-methoxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]but-2-enoate.
| Compound Name | methyl (E)-4-[(2S,4R)-6-methoxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]but-2-enoate |
|---|---|
| PubChem CID | 11393976 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | methyl (E)-4-[(2S,4R)-6-methoxy-4-[(4-methoxyphenyl)methoxy]oxan-2-yl]but-2-enoate |
| SMILES | COC(=O)/C=C/C[C@H]1C[C@@H](OCc2ccc(OC)cc2)CC(OC)O1 |
| InChI | InChI=1S/C19H26O6/c1-21-15-9-7-14(8-10-15)13-24-17-11-16(25-19(12-17)23-3)5-4-6-18(20)22-2/h4,6-10,16-17,19H,5,11-13H2,1-3H3/b6-4+/t16-,17+,19?/m0/s1 |
| InChIKey | VCVGYWAHYNJRQC-XLDJXTQUSA-N |
| XLogP | 2.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|